C21H26NO5P — CID 57279803
[2-oxo-2-[[(2S)-1-oxo-1-phenoxypropan-2-yl]amino]ethyl]-(4-phenylbutyl)phosphinic acid (PubChem CID 57279803) has the molecular formula C21H26NO5P and a molecular weight of 403.42 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-1-oxo-1-phenoxypropan-2-yl]amino]ethyl]-(4-phenylbutyl)phosphinic acid.
| Compound Name | [2-oxo-2-[[(2S)-1-oxo-1-phenoxypropan-2-yl]amino]ethyl]-(4-phenylbutyl)phosphinic acid |
|---|---|
| PubChem CID | 57279803 |
| Molecular Formula | C21H26NO5P |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | [2-oxo-2-[[(2S)-1-oxo-1-phenoxypropan-2-yl]amino]ethyl]-(4-phenylbutyl)phosphinic acid |
| SMILES | C[C@H](NC(=O)CP(=O)(O)CCCCc1ccccc1)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C21H26NO5P/c1-17(21(24)27-19-13-6-3-7-14-19)22-20(23)16-28(25,26)15-9-8-12-18-10-4-2-5-11-18/h2-7,10-11,13-14,17H,8-9,12,15-16H2,1H3,(H,22,23)(H,25,26)/t17-/m0/s1 |
| InChIKey | MJCMHACZYJHDNI-KRWDZBQOSA-N |
| XLogP | 3.39 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|