C19H23O5P — CID 10044169
[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]oxy-(3-phenylpropyl)phosphinic acid (PubChem CID 10044169) has the molecular formula C19H23O5P and a molecular weight of 362.36 g/mol. Its IUPAC name is [(2S)-1-oxo-1-phenylmethoxypropan-2-yl]oxy-(3-phenylpropyl)phosphinic acid.
| Compound Name | [(2S)-1-oxo-1-phenylmethoxypropan-2-yl]oxy-(3-phenylpropyl)phosphinic acid |
|---|---|
| PubChem CID | 10044169 |
| Molecular Formula | C19H23O5P |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [(2S)-1-oxo-1-phenylmethoxypropan-2-yl]oxy-(3-phenylpropyl)phosphinic acid |
| SMILES | C[C@H](OP(=O)(O)CCCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H23O5P/c1-16(19(20)23-15-18-11-6-3-7-12-18)24-25(21,22)14-8-13-17-9-4-2-5-10-17/h2-7,9-12,16H,8,13-15H2,1H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | WUDUDUOSPIRCPM-INIZCTEOSA-N |
| XLogP | 3.95 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|