C18H28NO5P — CID 54148828
(2S)-2-[[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]amino]hexanoic acid (PubChem CID 54148828) has the molecular formula C18H28NO5P and a molecular weight of 369.40 g/mol. Its IUPAC name is (2S)-2-[[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 54148828 |
| Molecular Formula | C18H28NO5P |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (2S)-2-[[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)CP(=O)(O)CCCCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H28NO5P/c1-2-3-12-16(18(21)22)19-17(20)14-25(23,24)13-8-7-11-15-9-5-4-6-10-15/h4-6,9-10,16H,2-3,7-8,11-14H2,1H3,(H,19,20)(H,21,22)(H,23,24)/t16-/m0/s1 |
| InChIKey | OGHKIAPAUVBXJH-INIZCTEOSA-N |
| XLogP | 3.04 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|