C31H41FNO8P — CID 22820634
2,2-dimethylpropanoyloxymethyl (2S,4S)-1-[2-[ethoxy(4-phenylbutyl)phosphoryl]acetyl]-4-(4-fluorophenoxy)pyrrolidine-2-carboxylate (PubChem CID 22820634) has the molecular formula C31H41FNO8P and a molecular weight of 605.64 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (2S,4S)-1-[2-[ethoxy(4-phenylbutyl)phosphoryl]acetyl]-4-(4-fluorophenoxy)pyrrolidine-2-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (2S,4S)-1-[2-[ethoxy(4-phenylbutyl)phosphoryl]acetyl]-4-(4-fluorophenoxy)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 22820634 |
| Molecular Formula | C31H41FNO8P |
| Molecular Weight | 605.64 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (2S,4S)-1-[2-[ethoxy(4-phenylbutyl)phosphoryl]acetyl]-4-(4-fluorophenoxy)pyrrolidine-2-carboxylate |
| SMILES | CCOP(=O)(CCCCc1ccccc1)CC(=O)N1C[C@@H](Oc2ccc(F)cc2)C[C@H]1C(=O)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C31H41FNO8P/c1-5-40-42(37,18-10-9-13-23-11-7-6-8-12-23)21-28(34)33-20-26(41-25-16-14-24(32)15-17-25)19-27(33)29(35)38-22-39-30(36)31(2,3)4/h6-8,11-12,14-17,26-27H,5,9-10,13,18-22H2,1-4H3/t26-,27-,42?/m0/s1 |
| InChIKey | FWBMTFZRAPDYHJ-WUMACPHVSA-N |
| XLogP | 5.60 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.64 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|