C11H19NO5 — CID 112632356
methyl 4-hydroxy-1-(4-methoxybutanoyl)pyrrolidine-2-carboxylate (PubChem CID 112632356) has the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. Its IUPAC name is methyl 4-hydroxy-1-(4-methoxybutanoyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 4-hydroxy-1-(4-methoxybutanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 112632356 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | methyl 4-hydroxy-1-(4-methoxybutanoyl)pyrrolidine-2-carboxylate |
| SMILES | COCCCC(=O)N1CC(O)CC1C(=O)OC |
| InChI | InChI=1S/C11H19NO5/c1-16-5-3-4-10(14)12-7-8(13)6-9(12)11(15)17-2/h8-9,13H,3-7H2,1-2H3 |
| InChIKey | ZGGCOIUNXKFOMX-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|