C10H14N4O4 — CID 112632463
methyl 4-hydroxy-1-[2-(triazol-1-yl)acetyl]pyrrolidine-2-carboxylate (PubChem CID 112632463) has the molecular formula C10H14N4O4 and a molecular weight of 254.25 g/mol. Its IUPAC name is methyl 4-hydroxy-1-[2-(triazol-1-yl)acetyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 4-hydroxy-1-[2-(triazol-1-yl)acetyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 112632463 |
| Molecular Formula | C10H14N4O4 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | methyl 4-hydroxy-1-[2-(triazol-1-yl)acetyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(O)CN1C(=O)Cn1ccnn1 |
| InChI | InChI=1S/C10H14N4O4/c1-18-10(17)8-4-7(15)5-14(8)9(16)6-13-3-2-11-12-13/h2-3,7-8,15H,4-6H2,1H3 |
| InChIKey | NMUSCPGIUQDNRU-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |