C15H26N4O6 — CID 70536332
6-amino-2-[(6-carboxyoxy-4-oxo-2,3,6,7,8,9-hexahydro-1H-pyridazino[1,2-a]pyridazin-3-yl)amino]hexanoic acid (PubChem CID 70536332) has the molecular formula C15H26N4O6 and a molecular weight of 358.40 g/mol. Its IUPAC name is 6-amino-2-[(6-carboxyoxy-4-oxo-2,3,6,7,8,9-hexahydro-1H-pyridazino[1,2-a]pyridazin-3-yl)amino]hexanoic acid.
| Compound Name | 6-amino-2-[(6-carboxyoxy-4-oxo-2,3,6,7,8,9-hexahydro-1H-pyridazino[1,2-a]pyridazin-3-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 70536332 |
| Molecular Formula | C15H26N4O6 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 6-amino-2-[(6-carboxyoxy-4-oxo-2,3,6,7,8,9-hexahydro-1H-pyridazino[1,2-a]pyridazin-3-yl)amino]hexanoic acid |
| SMILES | NCCCCC(NC1CCN2CCCC(OC(=O)O)N2C1=O)C(=O)O |
| InChI | InChI=1S/C15H26N4O6/c16-7-2-1-4-11(14(21)22)17-10-6-9-18-8-3-5-12(25-15(23)24)19(18)13(10)20/h10-12,17H,1-9,16H2,(H,21,22)(H,23,24) |
| InChIKey | LUJJRCGTJIAKIE-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 145.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|