C23H35N3O5 — CID 14301786
9-amino-2-[[1-(carboxymethyl)-2-oxo-6-phenylazepan-3-yl]amino]nonanoic acid (PubChem CID 14301786) has the molecular formula C23H35N3O5 and a molecular weight of 433.55 g/mol. Its IUPAC name is 9-amino-2-[[1-(carboxymethyl)-2-oxo-6-phenylazepan-3-yl]amino]nonanoic acid.
| Compound Name | 9-amino-2-[[1-(carboxymethyl)-2-oxo-6-phenylazepan-3-yl]amino]nonanoic acid |
|---|---|
| PubChem CID | 14301786 |
| Molecular Formula | C23H35N3O5 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 9-amino-2-[[1-(carboxymethyl)-2-oxo-6-phenylazepan-3-yl]amino]nonanoic acid |
| SMILES | NCCCCCCCC(NC1CCC(c2ccccc2)CN(CC(=O)O)C1=O)C(=O)O |
| InChI | InChI=1S/C23H35N3O5/c24-14-8-3-1-2-7-11-20(23(30)31)25-19-13-12-18(17-9-5-4-6-10-17)15-26(22(19)29)16-21(27)28/h4-6,9-10,18-20,25H,1-3,7-8,11-16,24H2,(H,27,28)(H,30,31) |
| InChIKey | AYVKNDDNWNKFSM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|