C15H27N3O5 — CID 18605785
(2S)-6-amino-2-[[(3S)-1-[(1S)-1-carboxyethyl]-2-oxoazepan-3-yl]amino]hexanoic acid (PubChem CID 18605785) has the molecular formula C15H27N3O5 and a molecular weight of 329.40 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(3S)-1-[(1S)-1-carboxyethyl]-2-oxoazepan-3-yl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(3S)-1-[(1S)-1-carboxyethyl]-2-oxoazepan-3-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18605785 |
| Molecular Formula | C15H27N3O5 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (2S)-6-amino-2-[[(3S)-1-[(1S)-1-carboxyethyl]-2-oxoazepan-3-yl]amino]hexanoic acid |
| SMILES | C[C@@H](C(=O)O)N1CCCC[C@H](N[C@@H](CCCCN)C(=O)O)C1=O |
| InChI | InChI=1S/C15H27N3O5/c1-10(14(20)21)18-9-5-3-6-11(13(18)19)17-12(15(22)23)7-2-4-8-16/h10-12,17H,2-9,16H2,1H3,(H,20,21)(H,22,23)/t10-,11-,12-/m0/s1 |
| InChIKey | KTKCEEBWPOTZES-SRVKXCTJSA-N |
| XLogP | 0.01 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|