C20H31N3O5S2 — CID 54539214
(2S)-9-amino-2-[[(2S,6R)-4-(carboxymethyl)-5-oxo-6-thiophen-2-yl-1,4-thiazepan-2-yl]amino]nonanoic acid (PubChem CID 54539214) has the molecular formula C20H31N3O5S2 and a molecular weight of 457.62 g/mol. Its IUPAC name is (2S)-9-amino-2-[[(2S,6R)-4-(carboxymethyl)-5-oxo-6-thiophen-2-yl-1,4-thiazepan-2-yl]amino]nonanoic acid.
| Compound Name | (2S)-9-amino-2-[[(2S,6R)-4-(carboxymethyl)-5-oxo-6-thiophen-2-yl-1,4-thiazepan-2-yl]amino]nonanoic acid |
|---|---|
| PubChem CID | 54539214 |
| Molecular Formula | C20H31N3O5S2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | (2S)-9-amino-2-[[(2S,6R)-4-(carboxymethyl)-5-oxo-6-thiophen-2-yl-1,4-thiazepan-2-yl]amino]nonanoic acid |
| SMILES | NCCCCCCC[C@H](N[C@@H]1CN(CC(=O)O)C(=O)[C@@H](c2cccs2)CS1)C(=O)O |
| InChI | InChI=1S/C20H31N3O5S2/c21-9-5-3-1-2-4-7-15(20(27)28)22-17-11-23(12-18(24)25)19(26)14(13-30-17)16-8-6-10-29-16/h6,8,10,14-15,17,22H,1-5,7,9,11-13,21H2,(H,24,25)(H,27,28)/t14-,15+,17+/m1/s1 |
| InChIKey | ZBYAKZBDEQWAJH-VYDXJSESSA-N |
| XLogP | 2.16 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|