C17H27Cl2N3O5S2 — CID 67825342
(2R)-6-amino-2-[[4-(carboxymethyl)-5-oxo-2-thiophen-2-yl-1,4-thiazepan-6-yl]amino]hexanoic acid;dihydrochloride (PubChem CID 67825342) has the molecular formula C17H27Cl2N3O5S2 and a molecular weight of 488.46 g/mol. Its IUPAC name is (2R)-6-amino-2-[[4-(carboxymethyl)-5-oxo-2-thiophen-2-yl-1,4-thiazepan-6-yl]amino]hexanoic acid;dihydrochloride.
| Compound Name | (2R)-6-amino-2-[[4-(carboxymethyl)-5-oxo-2-thiophen-2-yl-1,4-thiazepan-6-yl]amino]hexanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 67825342 |
| Molecular Formula | C17H27Cl2N3O5S2 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | (2R)-6-amino-2-[[4-(carboxymethyl)-5-oxo-2-thiophen-2-yl-1,4-thiazepan-6-yl]amino]hexanoic acid;dihydrochloride |
| SMILES | Cl.Cl.NCCCC[C@@H](NC1CSC(c2cccs2)CN(CC(=O)O)C1=O)C(=O)O |
| InChI | InChI=1S/C17H25N3O5S2.2ClH/c18-6-2-1-4-11(17(24)25)19-12-10-27-14(13-5-3-7-26-13)8-20(16(12)23)9-15(21)22;;/h3,5,7,11-12,14,19H,1-2,4,6,8-10,18H2,(H,21,22)(H,24,25);2*1H/t11-,12?,14?;;/m1../s1 |
| InChIKey | QBWDNSMJFAXVRF-LCBDVEBMSA-N |
| XLogP | 1.83 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|