C29H37N3O7 — CID 14552305
(2S)-1-[(2-carboxy-4-phenylbutyl)-[4-(phenylmethoxycarbonylamino)butyl]carbamoyl]pyrrolidine-2-carboxylic acid (PubChem CID 14552305) has the molecular formula C29H37N3O7 and a molecular weight of 539.63 g/mol. Its IUPAC name is (2S)-1-[(2-carboxy-4-phenylbutyl)-[4-(phenylmethoxycarbonylamino)butyl]carbamoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2-carboxy-4-phenylbutyl)-[4-(phenylmethoxycarbonylamino)butyl]carbamoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 14552305 |
| Molecular Formula | C29H37N3O7 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | (2S)-1-[(2-carboxy-4-phenylbutyl)-[4-(phenylmethoxycarbonylamino)butyl]carbamoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(NCCCCN(CC(CCc1ccccc1)C(=O)O)C(=O)N1CCC[C@H]1C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C29H37N3O7/c33-26(34)24(16-15-22-10-3-1-4-11-22)20-31(29(38)32-19-9-14-25(32)27(35)36)18-8-7-17-30-28(37)39-21-23-12-5-2-6-13-23/h1-6,10-13,24-25H,7-9,14-21H2,(H,30,37)(H,33,34)(H,35,36)/t24?,25-/m0/s1 |
| InChIKey | RICQRDMXVDNLSI-BBMPLOMVSA-N |
| XLogP | 4.00 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|