C28H35N2O10P — CID 54232398
(2S)-1-[2-[[(1S)-1-benzoyloxyethyl]-hydroxyphosphoryl]oxy-6-(phenylmethoxycarbonylamino)hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 54232398) has the molecular formula C28H35N2O10P and a molecular weight of 590.57 g/mol. Its IUPAC name is (2S)-1-[2-[[(1S)-1-benzoyloxyethyl]-hydroxyphosphoryl]oxy-6-(phenylmethoxycarbonylamino)hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-[[(1S)-1-benzoyloxyethyl]-hydroxyphosphoryl]oxy-6-(phenylmethoxycarbonylamino)hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54232398 |
| Molecular Formula | C28H35N2O10P |
| Molecular Weight | 590.57 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | (2S)-1-[2-[[(1S)-1-benzoyloxyethyl]-hydroxyphosphoryl]oxy-6-(phenylmethoxycarbonylamino)hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | C[C@@H](OC(=O)c1ccccc1)P(=O)(O)OC(CCCCNC(=O)OCc1ccccc1)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C28H35N2O10P/c1-20(39-27(34)22-13-6-3-7-14-22)41(36,37)40-24(25(31)30-18-10-15-23(30)26(32)33)16-8-9-17-29-28(35)38-19-21-11-4-2-5-12-21/h2-7,11-14,20,23-24H,8-10,15-19H2,1H3,(H,29,35)(H,32,33)(H,36,37)/t20-,23-,24?/m0/s1 |
| InChIKey | QKEMEEUWFDWQOE-AEPCKBASSA-N |
| XLogP | 3.93 |
| TPSA | 168.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|