C31H41N2O10P — CID 54206191
(2S)-1-[2-[[(1S)-1-benzoyloxypentyl]-hydroxyphosphoryl]oxy-6-(phenylmethoxycarbonylamino)hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 54206191) has the molecular formula C31H41N2O10P and a molecular weight of 632.65 g/mol. Its IUPAC name is (2S)-1-[2-[[(1S)-1-benzoyloxypentyl]-hydroxyphosphoryl]oxy-6-(phenylmethoxycarbonylamino)hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-[[(1S)-1-benzoyloxypentyl]-hydroxyphosphoryl]oxy-6-(phenylmethoxycarbonylamino)hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54206191 |
| Molecular Formula | C31H41N2O10P |
| Molecular Weight | 632.65 g/mol |
| Exact Mass | 632.25 |
| IUPAC Name | (2S)-1-[2-[[(1S)-1-benzoyloxypentyl]-hydroxyphosphoryl]oxy-6-(phenylmethoxycarbonylamino)hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCCC[C@@H](OC(=O)c1ccccc1)P(=O)(O)OC(CCCCNC(=O)OCc1ccccc1)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C31H41N2O10P/c1-2-3-19-27(42-30(37)24-15-8-5-9-16-24)44(39,40)43-26(28(34)33-21-12-17-25(33)29(35)36)18-10-11-20-32-31(38)41-22-23-13-6-4-7-14-23/h4-9,13-16,25-27H,2-3,10-12,17-22H2,1H3,(H,32,38)(H,35,36)(H,39,40)/t25-,26?,27-/m0/s1 |
| InChIKey | PSQKFCIPUMDLGD-LLOGBAKRSA-N |
| XLogP | 5.10 |
| TPSA | 168.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.65 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|