C33H51N4O10P — CID 54367251
(2S)-1-[(2S)-2-[[(2S)-2-[[(2S)-2-(cyclobutanecarbonylamino)-6-(phenylmethoxycarbonylamino)hexanoyl]amino]hexyl]-hydroxyphosphoryl]oxypropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 54367251) has the molecular formula C33H51N4O10P and a molecular weight of 694.76 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[[(2S)-2-[[(2S)-2-(cyclobutanecarbonylamino)-6-(phenylmethoxycarbonylamino)hexanoyl]amino]hexyl]-hydroxyphosphoryl]oxypropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-2-[[(2S)-2-[[(2S)-2-(cyclobutanecarbonylamino)-6-(phenylmethoxycarbonylamino)hexanoyl]amino]hexyl]-hydroxyphosphoryl]oxypropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54367251 |
| Molecular Formula | C33H51N4O10P |
| Molecular Weight | 694.76 g/mol |
| Exact Mass | 694.33 |
| IUPAC Name | (2S)-1-[(2S)-2-[[(2S)-2-[[(2S)-2-(cyclobutanecarbonylamino)-6-(phenylmethoxycarbonylamino)hexanoyl]amino]hexyl]-hydroxyphosphoryl]oxypropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCCC[C@@H](CP(=O)(O)O[C@@H](C)C(=O)N1CCC[C@H]1C(=O)O)NC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)C1CCC1 |
| InChI | InChI=1S/C33H51N4O10P/c1-3-4-16-26(22-48(44,45)47-23(2)31(40)37-20-11-18-28(37)32(41)42)35-30(39)27(36-29(38)25-14-10-15-25)17-8-9-19-34-33(43)46-21-24-12-6-5-7-13-24/h5-7,12-13,23,25-28H,3-4,8-11,14-22H2,1-2H3,(H,34,43)(H,35,39)(H,36,38)(H,41,42)(H,44,45)/t23-,26-,27-,28-/m0/s1 |
| InChIKey | UQQHQQSLVLUELH-WHHDSKRTSA-N |
| XLogP | 3.71 |
| TPSA | 200.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.76 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|