C27H40N4O8P+ — CID 70441517
[(1S)-1-[[(2S)-6-amino-2-(cyclobutanecarbonylamino)hexanoyl]amino]-2-phenylethoxy]-[1-[(2S)-2-carboxypyrrolidin-1-yl]-1-oxopropan-2-yl]oxy-oxophosphanium (PubChem CID 70441517) has the molecular formula C27H40N4O8P+ and a molecular weight of 579.61 g/mol. Its IUPAC name is [(1S)-1-[[(2S)-6-amino-2-(cyclobutanecarbonylamino)hexanoyl]amino]-2-phenylethoxy]-[1-[(2S)-2-carboxypyrrolidin-1-yl]-1-oxopropan-2-yl]oxy-oxophosphanium.
| Compound Name | [(1S)-1-[[(2S)-6-amino-2-(cyclobutanecarbonylamino)hexanoyl]amino]-2-phenylethoxy]-[1-[(2S)-2-carboxypyrrolidin-1-yl]-1-oxopropan-2-yl]oxy-oxophosphanium |
|---|---|
| PubChem CID | 70441517 |
| Molecular Formula | C27H40N4O8P+ |
| Molecular Weight | 579.61 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | [(1S)-1-[[(2S)-6-amino-2-(cyclobutanecarbonylamino)hexanoyl]amino]-2-phenylethoxy]-[1-[(2S)-2-carboxypyrrolidin-1-yl]-1-oxopropan-2-yl]oxy-oxophosphanium |
| SMILES | CC(O[P+](=O)O[C@@H](Cc1ccccc1)NC(=O)[C@H](CCCCN)NC(=O)C1CCC1)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C27H39N4O8P/c1-18(26(34)31-16-8-14-22(31)27(35)36)38-40(37)39-23(17-19-9-3-2-4-10-19)30-25(33)21(13-5-6-15-28)29-24(32)20-11-7-12-20/h2-4,9-10,18,20-23H,5-8,11-17,28H2,1H3,(H2-,29,30,32,33,35,36)/p+1/t18?,21-,22-,23-/m0/s1 |
| InChIKey | SPMZPRILACPXRM-VPEKBSMISA-O |
| XLogP | 2.24 |
| TPSA | 177.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.61 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|