C25H45N4O8P — CID 88617880
(2S)-1-[(2S)-2-[2-[[(2S)-6-amino-2-(cyclobutanecarbonylamino)hexanoyl]amino]hexyl-hydroxyphosphoryl]oxypropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 88617880) has the molecular formula C25H45N4O8P and a molecular weight of 560.63 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[2-[[(2S)-6-amino-2-(cyclobutanecarbonylamino)hexanoyl]amino]hexyl-hydroxyphosphoryl]oxypropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-2-[2-[[(2S)-6-amino-2-(cyclobutanecarbonylamino)hexanoyl]amino]hexyl-hydroxyphosphoryl]oxypropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 88617880 |
| Molecular Formula | C25H45N4O8P |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | (2S)-1-[(2S)-2-[2-[[(2S)-6-amino-2-(cyclobutanecarbonylamino)hexanoyl]amino]hexyl-hydroxyphosphoryl]oxypropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCCCC(CP(=O)(O)O[C@@H](C)C(=O)N1CCC[C@H]1C(=O)O)NC(=O)[C@H](CCCCN)NC(=O)C1CCC1 |
| InChI | InChI=1S/C25H45N4O8P/c1-3-4-11-19(27-23(31)20(12-5-6-14-26)28-22(30)18-9-7-10-18)16-38(35,36)37-17(2)24(32)29-15-8-13-21(29)25(33)34/h17-21H,3-16,26H2,1-2H3,(H,27,31)(H,28,30)(H,33,34)(H,35,36)/t17-,19?,20-,21-/m0/s1 |
| InChIKey | WEMQXEYSBGWEMF-QOKQSESGSA-N |
| XLogP | 1.74 |
| TPSA | 188.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|