C19H37N4O7P — CID 14551312
(2S)-1-[(2S)-2-[1-[[(2S)-2,6-diaminohexanoyl]amino]pentyl-hydroxyphosphoryl]oxypropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 14551312) has the molecular formula C19H37N4O7P and a molecular weight of 464.50 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[1-[[(2S)-2,6-diaminohexanoyl]amino]pentyl-hydroxyphosphoryl]oxypropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-2-[1-[[(2S)-2,6-diaminohexanoyl]amino]pentyl-hydroxyphosphoryl]oxypropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 14551312 |
| Molecular Formula | C19H37N4O7P |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | (2S)-1-[(2S)-2-[1-[[(2S)-2,6-diaminohexanoyl]amino]pentyl-hydroxyphosphoryl]oxypropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCCCC(NC(=O)[C@@H](N)CCCCN)P(=O)(O)O[C@@H](C)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C19H37N4O7P/c1-3-4-10-16(22-17(24)14(21)8-5-6-11-20)31(28,29)30-13(2)18(25)23-12-7-9-15(23)19(26)27/h13-16H,3-12,20-21H2,1-2H3,(H,22,24)(H,26,27)(H,28,29)/t13-,14-,15-,16?/m0/s1 |
| InChIKey | OLYMKWLLTHVLCY-HEHBBPHXSA-N |
| XLogP | 0.74 |
| TPSA | 185.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|