C22H35N4O7P — CID 18633131
(2S)-1-[2-[[(1S)-1-[[(2S)-2,6-diaminohexanoyl]amino]-2-phenylethyl]-hydroxyphosphoryl]oxypropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18633131) has the molecular formula C22H35N4O7P and a molecular weight of 498.52 g/mol. Its IUPAC name is (2S)-1-[2-[[(1S)-1-[[(2S)-2,6-diaminohexanoyl]amino]-2-phenylethyl]-hydroxyphosphoryl]oxypropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-[[(1S)-1-[[(2S)-2,6-diaminohexanoyl]amino]-2-phenylethyl]-hydroxyphosphoryl]oxypropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18633131 |
| Molecular Formula | C22H35N4O7P |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | (2S)-1-[2-[[(1S)-1-[[(2S)-2,6-diaminohexanoyl]amino]-2-phenylethyl]-hydroxyphosphoryl]oxypropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(OP(=O)(O)[C@@H](Cc1ccccc1)NC(=O)[C@@H](N)CCCCN)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C22H35N4O7P/c1-15(21(28)26-13-7-11-18(26)22(29)30)33-34(31,32)19(14-16-8-3-2-4-9-16)25-20(27)17(24)10-5-6-12-23/h2-4,8-9,15,17-19H,5-7,10-14,23-24H2,1H3,(H,25,27)(H,29,30)(H,31,32)/t15?,17-,18-,19-/m0/s1 |
| InChIKey | JMOXLSNPRUPVFG-SFJQHFOJSA-N |
| XLogP | 0.79 |
| TPSA | 185.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|