C23H35N5O6 — CID 18302694
1-[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18302694) has the molecular formula C23H35N5O6 and a molecular weight of 477.56 g/mol. Its IUPAC name is 1-[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18302694 |
| Molecular Formula | C23H35N5O6 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | 1-[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(NC(=O)C(N)CCCCN)C(=O)NC(Cc1ccc(O)cc1)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C23H35N5O6/c1-14(26-21(31)17(25)5-2-3-11-24)20(30)27-18(13-15-7-9-16(29)10-8-15)22(32)28-12-4-6-19(28)23(33)34/h7-10,14,17-19,29H,2-6,11-13,24-25H2,1H3,(H,26,31)(H,27,30)(H,33,34) |
| InChIKey | QMKHDVACUBXUQH-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 188.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|