C19H28N2O6P+ — CID 70364497
[6-amino-1-[(2S)-2-carboxypyrrolidin-1-yl]-1-oxohexan-2-yl]oxy-[(1S)-1-hydroxy-2-phenylethyl]-oxophosphanium (PubChem CID 70364497) has the molecular formula C19H28N2O6P+ and a molecular weight of 411.42 g/mol. Its IUPAC name is [6-amino-1-[(2S)-2-carboxypyrrolidin-1-yl]-1-oxohexan-2-yl]oxy-[(1S)-1-hydroxy-2-phenylethyl]-oxophosphanium.
| Compound Name | [6-amino-1-[(2S)-2-carboxypyrrolidin-1-yl]-1-oxohexan-2-yl]oxy-[(1S)-1-hydroxy-2-phenylethyl]-oxophosphanium |
|---|---|
| PubChem CID | 70364497 |
| Molecular Formula | C19H28N2O6P+ |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | [6-amino-1-[(2S)-2-carboxypyrrolidin-1-yl]-1-oxohexan-2-yl]oxy-[(1S)-1-hydroxy-2-phenylethyl]-oxophosphanium |
| SMILES | NCCCCC(O[P+](=O)[C@H](O)Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C19H27N2O6P/c20-11-5-4-10-16(18(23)21-12-6-9-15(21)19(24)25)27-28(26)17(22)13-14-7-2-1-3-8-14/h1-3,7-8,15-17,22H,4-6,9-13,20H2/p+1/t15-,16?,17-/m0/s1 |
| InChIKey | YKWPODBZBGCDBO-QRFGZVGRSA-O |
| XLogP | 1.88 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|