C22H34N2O6P+ — CID 70364474
[6-amino-1-[(2S)-2-carboxypyrrolidin-1-yl]-1-oxohexan-2-yl]oxy-[(1S)-1-hydroxy-5-phenylpentyl]-oxophosphanium (PubChem CID 70364474) has the molecular formula C22H34N2O6P+ and a molecular weight of 453.50 g/mol. Its IUPAC name is [6-amino-1-[(2S)-2-carboxypyrrolidin-1-yl]-1-oxohexan-2-yl]oxy-[(1S)-1-hydroxy-5-phenylpentyl]-oxophosphanium.
| Compound Name | [6-amino-1-[(2S)-2-carboxypyrrolidin-1-yl]-1-oxohexan-2-yl]oxy-[(1S)-1-hydroxy-5-phenylpentyl]-oxophosphanium |
|---|---|
| PubChem CID | 70364474 |
| Molecular Formula | C22H34N2O6P+ |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | [6-amino-1-[(2S)-2-carboxypyrrolidin-1-yl]-1-oxohexan-2-yl]oxy-[(1S)-1-hydroxy-5-phenylpentyl]-oxophosphanium |
| SMILES | NCCCCC(O[P+](=O)[C@H](O)CCCCc1ccccc1)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C22H33N2O6P/c23-15-7-6-13-19(21(26)24-16-8-12-18(24)22(27)28)30-31(29)20(25)14-5-4-11-17-9-2-1-3-10-17/h1-3,9-10,18-20,25H,4-8,11-16,23H2/p+1/t18-,19?,20-/m0/s1 |
| InChIKey | SZXZWNAGHFKUAJ-WMEOFMBSSA-O |
| XLogP | 3.05 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|