C25H39N3O5 — CID 59825302
(2S)-1-[(2S)-6-amino-2-[tert-butyl-[(1S)-1-carboxy-3-phenylpropyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 59825302) has the molecular formula C25H39N3O5 and a molecular weight of 461.60 g/mol. Its IUPAC name is (2S)-1-[(2S)-6-amino-2-[tert-butyl-[(1S)-1-carboxy-3-phenylpropyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-6-amino-2-[tert-butyl-[(1S)-1-carboxy-3-phenylpropyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 59825302 |
| Molecular Formula | C25H39N3O5 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.29 |
| IUPAC Name | (2S)-1-[(2S)-6-amino-2-[tert-butyl-[(1S)-1-carboxy-3-phenylpropyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)N([C@@H](CCc1ccccc1)C(=O)O)[C@@H](CCCCN)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C25H39N3O5/c1-25(2,3)28(21(24(32)33)15-14-18-10-5-4-6-11-18)19(12-7-8-16-26)22(29)27-17-9-13-20(27)23(30)31/h4-6,10-11,19-21H,7-9,12-17,26H2,1-3H3,(H,30,31)(H,32,33)/t19-,20-,21-/m0/s1 |
| InChIKey | APIBXPKMZCIJMJ-ACRUOGEOSA-N |
| XLogP | 2.75 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|