C35H54N4O10P+ — CID 88617888
2-[[2-(cyclohexanecarbonylamino)-6-(phenylmethoxycarbonylamino)hexanoyl]amino]hexoxy-oxo-[1-oxo-1-[(2S)-pyrrolidine-2-carbonyl]oxypropan-2-yl]oxyphosphanium (PubChem CID 88617888) has the molecular formula C35H54N4O10P+ and a molecular weight of 721.81 g/mol. Its IUPAC name is 2-[[2-(cyclohexanecarbonylamino)-6-(phenylmethoxycarbonylamino)hexanoyl]amino]hexoxy-oxo-[1-oxo-1-[(2S)-pyrrolidine-2-carbonyl]oxypropan-2-yl]oxyphosphanium.
| Compound Name | 2-[[2-(cyclohexanecarbonylamino)-6-(phenylmethoxycarbonylamino)hexanoyl]amino]hexoxy-oxo-[1-oxo-1-[(2S)-pyrrolidine-2-carbonyl]oxypropan-2-yl]oxyphosphanium |
|---|---|
| PubChem CID | 88617888 |
| Molecular Formula | C35H54N4O10P+ |
| Molecular Weight | 721.81 g/mol |
| Exact Mass | 721.36 |
| IUPAC Name | 2-[[2-(cyclohexanecarbonylamino)-6-(phenylmethoxycarbonylamino)hexanoyl]amino]hexoxy-oxo-[1-oxo-1-[(2S)-pyrrolidine-2-carbonyl]oxypropan-2-yl]oxyphosphanium |
| SMILES | CCCCC(CO[P+](=O)OC(C)C(=O)OC(=O)[C@@H]1CCCN1)NC(=O)C(CCCCNC(=O)OCc1ccccc1)NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C35H53N4O10P/c1-3-4-18-28(24-47-50(45)49-25(2)33(42)48-34(43)30-20-13-22-36-30)38-32(41)29(39-31(40)27-16-9-6-10-17-27)19-11-12-21-37-35(44)46-23-26-14-7-5-8-15-26/h5,7-8,14-15,25,27-30,36H,3-4,6,9-13,16-24H2,1-2H3,(H2-,37,38,39,40,41,44)/p+1/t25?,28?,29?,30-/m0/s1 |
| InChIKey | KYKPRFPNILVJSQ-RZFWVVNCSA-O |
| XLogP | 4.72 |
| TPSA | 187.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.81 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|