C15H28N2O6P+ — CID 88617906
2-aminoheptoxy-oxo-[1-oxo-1-[(2S)-pyrrolidine-2-carbonyl]oxypropan-2-yl]oxyphosphanium (PubChem CID 88617906) has the molecular formula C15H28N2O6P+ and a molecular weight of 363.37 g/mol. Its IUPAC name is 2-aminoheptoxy-oxo-[1-oxo-1-[(2S)-pyrrolidine-2-carbonyl]oxypropan-2-yl]oxyphosphanium.
| Compound Name | 2-aminoheptoxy-oxo-[1-oxo-1-[(2S)-pyrrolidine-2-carbonyl]oxypropan-2-yl]oxyphosphanium |
|---|---|
| PubChem CID | 88617906 |
| Molecular Formula | C15H28N2O6P+ |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-aminoheptoxy-oxo-[1-oxo-1-[(2S)-pyrrolidine-2-carbonyl]oxypropan-2-yl]oxyphosphanium |
| SMILES | CCCCCC(N)CO[P+](=O)OC(C)C(=O)OC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C15H28N2O6P/c1-3-4-5-7-12(16)10-21-24(20)23-11(2)14(18)22-15(19)13-8-6-9-17-13/h11-13,17H,3-10,16H2,1-2H3/q+1/t11?,12?,13-/m0/s1 |
| InChIKey | OFMBTZKIKUDJLR-BPCQOVAHSA-N |
| XLogP | 1.79 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|