C27H38F3N3O9P+ — CID 88617889
oxo-[1-oxo-1-[(2S)-pyrrolidine-2-carbonyl]oxy-6-[(2,2,2-trifluoroacetyl)amino]hexan-2-yl]oxy-[2-(phenylmethoxycarbonylamino)hexoxy]phosphanium (PubChem CID 88617889) has the molecular formula C27H38F3N3O9P+ and a molecular weight of 636.58 g/mol. Its IUPAC name is oxo-[1-oxo-1-[(2S)-pyrrolidine-2-carbonyl]oxy-6-[(2,2,2-trifluoroacetyl)amino]hexan-2-yl]oxy-[2-(phenylmethoxycarbonylamino)hexoxy]phosphanium.
| Compound Name | oxo-[1-oxo-1-[(2S)-pyrrolidine-2-carbonyl]oxy-6-[(2,2,2-trifluoroacetyl)amino]hexan-2-yl]oxy-[2-(phenylmethoxycarbonylamino)hexoxy]phosphanium |
|---|---|
| PubChem CID | 88617889 |
| Molecular Formula | C27H38F3N3O9P+ |
| Molecular Weight | 636.58 g/mol |
| Exact Mass | 636.23 |
| IUPAC Name | oxo-[1-oxo-1-[(2S)-pyrrolidine-2-carbonyl]oxy-6-[(2,2,2-trifluoroacetyl)amino]hexan-2-yl]oxy-[2-(phenylmethoxycarbonylamino)hexoxy]phosphanium |
| SMILES | CCCCC(CO[P+](=O)OC(CCCCNC(=O)C(F)(F)F)C(=O)OC(=O)[C@@H]1CCCN1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H37F3N3O9P/c1-2-3-12-20(33-26(37)39-17-19-10-5-4-6-11-19)18-40-43(38)42-22(14-7-8-15-32-25(36)27(28,29)30)24(35)41-23(34)21-13-9-16-31-21/h4-6,10-11,20-22,31H,2-3,7-9,12-18H2,1H3,(H-,32,33,36,37)/p+1/t20?,21-,22?/m0/s1 |
| InChIKey | HZVLYXUBECJTKR-ORFBVSJDSA-O |
| XLogP | 4.20 |
| TPSA | 158.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|