C26H40IN2O8P — CID 88665599
heptyl-[2-iodo-1-oxo-6-(phenylmethoxycarbonylamino)-1-[(2S)-pyrrolidine-2-carbonyl]oxyhexan-2-yl]oxyphosphinic acid (PubChem CID 88665599) has the molecular formula C26H40IN2O8P and a molecular weight of 666.49 g/mol. Its IUPAC name is heptyl-[2-iodo-1-oxo-6-(phenylmethoxycarbonylamino)-1-[(2S)-pyrrolidine-2-carbonyl]oxyhexan-2-yl]oxyphosphinic acid.
| Compound Name | heptyl-[2-iodo-1-oxo-6-(phenylmethoxycarbonylamino)-1-[(2S)-pyrrolidine-2-carbonyl]oxyhexan-2-yl]oxyphosphinic acid |
|---|---|
| PubChem CID | 88665599 |
| Molecular Formula | C26H40IN2O8P |
| Molecular Weight | 666.49 g/mol |
| Exact Mass | 666.16 |
| IUPAC Name | heptyl-[2-iodo-1-oxo-6-(phenylmethoxycarbonylamino)-1-[(2S)-pyrrolidine-2-carbonyl]oxyhexan-2-yl]oxyphosphinic acid |
| SMILES | CCCCCCCP(=O)(O)OC(I)(CCCCNC(=O)OCc1ccccc1)C(=O)OC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C26H40IN2O8P/c1-2-3-4-5-11-19-38(33,34)37-26(27,24(31)36-23(30)22-15-12-18-28-22)16-9-10-17-29-25(32)35-20-21-13-7-6-8-14-21/h6-8,13-14,22,28H,2-5,9-12,15-20H2,1H3,(H,29,32)(H,33,34)/t22-,26?/m0/s1 |
| InChIKey | OEFFTQUKWJZDDQ-CHQVSRGASA-N |
| XLogP | 5.21 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|