C27H40F3N3O9P+ — CID 57228912
(2R)-1-[2-[hydroxy-[(1S)-1-(phenylmethoxycarbonylamino)pentyl]phosphoryl]oxy-6-[(2,2,2-trifluoroacetyl)amino]hexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57228912) has the molecular formula C27H40F3N3O9P+ and a molecular weight of 638.60 g/mol. Its IUPAC name is (2R)-1-[2-[hydroxy-[(1S)-1-(phenylmethoxycarbonylamino)pentyl]phosphoryl]oxy-6-[(2,2,2-trifluoroacetyl)amino]hexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[2-[hydroxy-[(1S)-1-(phenylmethoxycarbonylamino)pentyl]phosphoryl]oxy-6-[(2,2,2-trifluoroacetyl)amino]hexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57228912 |
| Molecular Formula | C27H40F3N3O9P+ |
| Molecular Weight | 638.60 g/mol |
| Exact Mass | 638.24 |
| IUPAC Name | (2R)-1-[2-[hydroxy-[(1S)-1-(phenylmethoxycarbonylamino)pentyl]phosphoryl]oxy-6-[(2,2,2-trifluoroacetyl)amino]hexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CCCC[C@@H](NC(=O)OCc1ccccc1)P(=O)(O)OC(CCCCNC(=O)C(F)(F)F)C(=O)[N+]1(C(=O)O)CCC[C@H]1C |
| InChI | InChI=1S/C27H39F3N3O9P/c1-3-4-15-22(32-25(36)41-18-20-12-6-5-7-13-20)43(39,40)42-21(14-8-9-16-31-24(35)27(28,29)30)23(34)33(26(37)38)17-10-11-19(33)2/h5-7,12-13,19,21-22H,3-4,8-11,14-18H2,1-2H3,(H3-,31,32,35,36,37,38,39,40)/p+1/t19-,21?,22+,33?/m1/s1 |
| InChIKey | DOHQVWDQRMYULB-NDOWFLNFSA-O |
| XLogP | 5.05 |
| TPSA | 168.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.60 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|