C22H35FN2O6P+ — CID 56622198
(1S)-1-[6-amino-2-[4-(4-fluorophenyl)butyl-hydroxyphosphoryl]oxyhexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 56622198) has the molecular formula C22H35FN2O6P+ and a molecular weight of 473.50 g/mol. Its IUPAC name is (1S)-1-[6-amino-2-[4-(4-fluorophenyl)butyl-hydroxyphosphoryl]oxyhexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (1S)-1-[6-amino-2-[4-(4-fluorophenyl)butyl-hydroxyphosphoryl]oxyhexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 56622198 |
| Molecular Formula | C22H35FN2O6P+ |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | (1S)-1-[6-amino-2-[4-(4-fluorophenyl)butyl-hydroxyphosphoryl]oxyhexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC1CCC[N@@+]1(C(=O)O)C(=O)C(CCCCN)OP(=O)(O)CCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H34FN2O6P/c1-17-7-6-15-25(17,22(27)28)21(26)20(9-2-4-14-24)31-32(29,30)16-5-3-8-18-10-12-19(23)13-11-18/h10-13,17,20H,2-9,14-16,24H2,1H3,(H-,27,28,29,30)/p+1/t17?,20?,25-/m0/s1 |
| InChIKey | FNZRYHPESYSBSN-ZPZJFZDTSA-O |
| XLogP | 4.05 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|