C24H38N3O6+ — CID 57316522
(2R)-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]-6-(2-hydroxyethylamino)hexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57316522) has the molecular formula C24H38N3O6+ and a molecular weight of 464.58 g/mol. Its IUPAC name is (2R)-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]-6-(2-hydroxyethylamino)hexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]-6-(2-hydroxyethylamino)hexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57316522 |
| Molecular Formula | C24H38N3O6+ |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | (2R)-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]-6-(2-hydroxyethylamino)hexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)O)C(=O)[C@H](CCCCNCCO)N[C@@H](CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H37N3O6/c1-18-8-7-16-27(18,24(32)33)22(29)20(11-5-6-14-25-15-17-28)26-21(23(30)31)13-12-19-9-3-2-4-10-19/h2-4,9-10,18,20-21,25-26,28H,5-8,11-17H2,1H3,(H-,30,31,32,33)/p+1/t18-,20+,21+,27?/m1/s1 |
| InChIKey | HJDAVNADVYDMJX-QTBRFDMDSA-O |
| XLogP | 1.99 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|