C25H39N4O6+ — CID 57204850
(2R)-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]-6-[[2-(methylamino)acetyl]amino]hexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57204850) has the molecular formula C25H39N4O6+ and a molecular weight of 491.61 g/mol. Its IUPAC name is (2R)-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]-6-[[2-(methylamino)acetyl]amino]hexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]-6-[[2-(methylamino)acetyl]amino]hexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57204850 |
| Molecular Formula | C25H39N4O6+ |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | (2R)-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]-6-[[2-(methylamino)acetyl]amino]hexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CNCC(=O)NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)[N+]1(C(=O)O)CCC[C@H]1C |
| InChI | InChI=1S/C25H38N4O6/c1-18-9-8-16-29(18,25(34)35)23(31)20(12-6-7-15-27-22(30)17-26-2)28-21(24(32)33)14-13-19-10-4-3-5-11-19/h3-5,10-11,18,20-21,26,28H,6-9,12-17H2,1-2H3,(H2-,27,30,32,33,34,35)/p+1/t18-,20+,21+,29?/m1/s1 |
| InChIKey | JOADNCDRYKOWBQ-OAYSHNLDSA-O |
| XLogP | 1.74 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|