C30H41N2O7P+2 — CID 56627184
[(2S)-1-[(2R)-1-carboxy-2-methylpyrrolidin-1-ium-1-yl]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]oxy-oxo-(4-phenylbutyl)phosphanium (PubChem CID 56627184) has the molecular formula C30H41N2O7P+2 and a molecular weight of 572.64 g/mol. Its IUPAC name is [(2S)-1-[(2R)-1-carboxy-2-methylpyrrolidin-1-ium-1-yl]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]oxy-oxo-(4-phenylbutyl)phosphanium.
| Compound Name | [(2S)-1-[(2R)-1-carboxy-2-methylpyrrolidin-1-ium-1-yl]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]oxy-oxo-(4-phenylbutyl)phosphanium |
|---|---|
| PubChem CID | 56627184 |
| Molecular Formula | C30H41N2O7P+2 |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | [(2S)-1-[(2R)-1-carboxy-2-methylpyrrolidin-1-ium-1-yl]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]oxy-oxo-(4-phenylbutyl)phosphanium |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)O)C(=O)[C@H](CCCCNC(=O)OCc1ccccc1)O[P+](=O)CCCCc1ccccc1 |
| InChI | InChI=1S/C30H39N2O7P/c1-24-13-12-21-32(24,30(35)36)28(33)27(39-40(37)22-11-9-16-25-14-4-2-5-15-25)19-8-10-20-31-29(34)38-23-26-17-6-3-7-18-26/h2-7,14-15,17-18,24,27H,8-13,16,19-23H2,1H3/p+2/t24-,27+,32?/m1/s1 |
| InChIKey | INPQAKCPWWFEIU-XFASPFKOSA-P |
| XLogP | 6.44 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|