C21H25NO7P+ — CID 90765384
[1-carboxy-5-(phenylmethoxycarbonylamino)pentoxy]-oxo-phenylmethoxyphosphanium (PubChem CID 90765384) has the molecular formula C21H25NO7P+ and a molecular weight of 434.41 g/mol. Its IUPAC name is [1-carboxy-5-(phenylmethoxycarbonylamino)pentoxy]-oxo-phenylmethoxyphosphanium.
| Compound Name | [1-carboxy-5-(phenylmethoxycarbonylamino)pentoxy]-oxo-phenylmethoxyphosphanium |
|---|---|
| PubChem CID | 90765384 |
| Molecular Formula | C21H25NO7P+ |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | [1-carboxy-5-(phenylmethoxycarbonylamino)pentoxy]-oxo-phenylmethoxyphosphanium |
| SMILES | O=C(NCCCCC(O[P+](=O)OCc1ccccc1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C21H24NO7P/c23-20(24)19(29-30(26)28-16-18-11-5-2-6-12-18)13-7-8-14-22-21(25)27-15-17-9-3-1-4-10-17/h1-6,9-12,19H,7-8,13-16H2,(H-,22,23,24,25)/p+1 |
| InChIKey | FQRKPKKJANZQLK-UHFFFAOYSA-O |
| XLogP | 4.43 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|