C20H31N2O6PS — CID 14630815
(2S)-3-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-1,3-thiazolidine-2-carboxylic acid (PubChem CID 14630815) has the molecular formula C20H31N2O6PS and a molecular weight of 458.52 g/mol. Its IUPAC name is (2S)-3-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-1,3-thiazolidine-2-carboxylic acid.
| Compound Name | (2S)-3-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-1,3-thiazolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 14630815 |
| Molecular Formula | C20H31N2O6PS |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | (2S)-3-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-1,3-thiazolidine-2-carboxylic acid |
| SMILES | NCCCC[C@H](OP(=O)(O)CCCCc1ccccc1)C(=O)N1CCS[C@H]1C(=O)O |
| InChI | InChI=1S/C20H31N2O6PS/c21-12-6-4-11-17(18(23)22-13-15-30-19(22)20(24)25)28-29(26,27)14-7-5-10-16-8-2-1-3-9-16/h1-3,8-9,17,19H,4-7,10-15,21H2,(H,24,25)(H,26,27)/t17-,19-/m0/s1 |
| InChIKey | UJKCPFZOBMSIJL-HKUYNNGSSA-N |
| XLogP | 2.69 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|