C19H31N2O6P — CID 20592162
6-amino-2-[hydroxy-[(1S)-2-methyl-1-(3-phenylpropanoylamino)propyl]phosphoryl]oxyhexanoic acid (PubChem CID 20592162) has the molecular formula C19H31N2O6P and a molecular weight of 414.44 g/mol. Its IUPAC name is 6-amino-2-[hydroxy-[(1S)-2-methyl-1-(3-phenylpropanoylamino)propyl]phosphoryl]oxyhexanoic acid.
| Compound Name | 6-amino-2-[hydroxy-[(1S)-2-methyl-1-(3-phenylpropanoylamino)propyl]phosphoryl]oxyhexanoic acid |
|---|---|
| PubChem CID | 20592162 |
| Molecular Formula | C19H31N2O6P |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 6-amino-2-[hydroxy-[(1S)-2-methyl-1-(3-phenylpropanoylamino)propyl]phosphoryl]oxyhexanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)CCc1ccccc1)P(=O)(O)OC(CCCCN)C(=O)O |
| InChI | InChI=1S/C19H31N2O6P/c1-14(2)18(21-17(22)12-11-15-8-4-3-5-9-15)28(25,26)27-16(19(23)24)10-6-7-13-20/h3-5,8-9,14,16,18H,6-7,10-13,20H2,1-2H3,(H,21,22)(H,23,24)(H,25,26)/t16?,18-/m0/s1 |
| InChIKey | KCAIWQMWEQOUCN-DAFXYXGESA-N |
| XLogP | 2.50 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|