C21H33N2O7P — CID 22717925
6-amino-2-[hydroxy-[oxan-4-yl-(3-phenylpropanoylamino)methyl]phosphoryl]oxyhexanoic acid (PubChem CID 22717925) has the molecular formula C21H33N2O7P and a molecular weight of 456.48 g/mol. Its IUPAC name is 6-amino-2-[hydroxy-[oxan-4-yl-(3-phenylpropanoylamino)methyl]phosphoryl]oxyhexanoic acid.
| Compound Name | 6-amino-2-[hydroxy-[oxan-4-yl-(3-phenylpropanoylamino)methyl]phosphoryl]oxyhexanoic acid |
|---|---|
| PubChem CID | 22717925 |
| Molecular Formula | C21H33N2O7P |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 6-amino-2-[hydroxy-[oxan-4-yl-(3-phenylpropanoylamino)methyl]phosphoryl]oxyhexanoic acid |
| SMILES | NCCCCC(OP(=O)(O)C(NC(=O)CCc1ccccc1)C1CCOCC1)C(=O)O |
| InChI | InChI=1S/C21H33N2O7P/c22-13-5-4-8-18(21(25)26)30-31(27,28)20(17-11-14-29-15-12-17)23-19(24)10-9-16-6-2-1-3-7-16/h1-3,6-7,17-18,20H,4-5,8-15,22H2,(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | FVVMQOMCVHZDPF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|