C20H33N2O5P — CID 22718004
6-amino-2-[hydroxy-[2-methyl-1-(3-phenylpropanoylamino)propyl]phosphoryl]-2-methylhexanoic acid (PubChem CID 22718004) has the molecular formula C20H33N2O5P and a molecular weight of 412.47 g/mol. Its IUPAC name is 6-amino-2-[hydroxy-[2-methyl-1-(3-phenylpropanoylamino)propyl]phosphoryl]-2-methylhexanoic acid.
| Compound Name | 6-amino-2-[hydroxy-[2-methyl-1-(3-phenylpropanoylamino)propyl]phosphoryl]-2-methylhexanoic acid |
|---|---|
| PubChem CID | 22718004 |
| Molecular Formula | C20H33N2O5P |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 6-amino-2-[hydroxy-[2-methyl-1-(3-phenylpropanoylamino)propyl]phosphoryl]-2-methylhexanoic acid |
| SMILES | CC(C)C(NC(=O)CCc1ccccc1)P(=O)(O)C(C)(CCCCN)C(=O)O |
| InChI | InChI=1S/C20H33N2O5P/c1-15(2)18(22-17(23)12-11-16-9-5-4-6-10-16)28(26,27)20(3,19(24)25)13-7-8-14-21/h4-6,9-10,15,18H,7-8,11-14,21H2,1-3H3,(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | GHNUTXXDSVDCAW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|