C17H27N2O6P — CID 12989019
(2S)-6-amino-2-[hydroxy-[1-(3-phenylpropanoylamino)ethyl]phosphoryl]oxyhexanoic acid (PubChem CID 12989019) has the molecular formula C17H27N2O6P and a molecular weight of 386.39 g/mol. Its IUPAC name is (2S)-6-amino-2-[hydroxy-[1-(3-phenylpropanoylamino)ethyl]phosphoryl]oxyhexanoic acid.
| Compound Name | (2S)-6-amino-2-[hydroxy-[1-(3-phenylpropanoylamino)ethyl]phosphoryl]oxyhexanoic acid |
|---|---|
| PubChem CID | 12989019 |
| Molecular Formula | C17H27N2O6P |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (2S)-6-amino-2-[hydroxy-[1-(3-phenylpropanoylamino)ethyl]phosphoryl]oxyhexanoic acid |
| SMILES | CC(NC(=O)CCc1ccccc1)P(=O)(O)O[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C17H27N2O6P/c1-13(19-16(20)11-10-14-7-3-2-4-8-14)26(23,24)25-15(17(21)22)9-5-6-12-18/h2-4,7-8,13,15H,5-6,9-12,18H2,1H3,(H,19,20)(H,21,22)(H,23,24)/t13?,15-/m0/s1 |
| InChIKey | XMYGTQIQSMVYBY-WUJWULDRSA-N |
| XLogP | 1.87 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|