C19H32N3O6P — CID 20592136
6-amino-2-[[(1S)-1-[3-(4-aminophenyl)propanoylamino]-2-methylpropyl]-hydroxyphosphoryl]oxyhexanoic acid (PubChem CID 20592136) has the molecular formula C19H32N3O6P and a molecular weight of 429.45 g/mol. Its IUPAC name is 6-amino-2-[[(1S)-1-[3-(4-aminophenyl)propanoylamino]-2-methylpropyl]-hydroxyphosphoryl]oxyhexanoic acid.
| Compound Name | 6-amino-2-[[(1S)-1-[3-(4-aminophenyl)propanoylamino]-2-methylpropyl]-hydroxyphosphoryl]oxyhexanoic acid |
|---|---|
| PubChem CID | 20592136 |
| Molecular Formula | C19H32N3O6P |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 6-amino-2-[[(1S)-1-[3-(4-aminophenyl)propanoylamino]-2-methylpropyl]-hydroxyphosphoryl]oxyhexanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)CCc1ccc(N)cc1)P(=O)(O)OC(CCCCN)C(=O)O |
| InChI | InChI=1S/C19H32N3O6P/c1-13(2)18(22-17(23)11-8-14-6-9-15(21)10-7-14)29(26,27)28-16(19(24)25)5-3-4-12-20/h6-7,9-10,13,16,18H,3-5,8,11-12,20-21H2,1-2H3,(H,22,23)(H,24,25)(H,26,27)/t16?,18-/m0/s1 |
| InChIKey | QLMMVCPVHCJQSY-DAFXYXGESA-N |
| XLogP | 2.08 |
| TPSA | 164.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|