C12H25N2O6P — CID 20592124
2-[[(1S)-1-acetamido-2-methylpropyl]-hydroxyphosphoryl]oxy-6-aminohexanoic acid (PubChem CID 20592124) has the molecular formula C12H25N2O6P and a molecular weight of 324.31 g/mol. Its IUPAC name is 2-[[(1S)-1-acetamido-2-methylpropyl]-hydroxyphosphoryl]oxy-6-aminohexanoic acid.
| Compound Name | 2-[[(1S)-1-acetamido-2-methylpropyl]-hydroxyphosphoryl]oxy-6-aminohexanoic acid |
|---|---|
| PubChem CID | 20592124 |
| Molecular Formula | C12H25N2O6P |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-[[(1S)-1-acetamido-2-methylpropyl]-hydroxyphosphoryl]oxy-6-aminohexanoic acid |
| SMILES | CC(=O)N[C@H](C(C)C)P(=O)(O)OC(CCCCN)C(=O)O |
| InChI | InChI=1S/C12H25N2O6P/c1-8(2)11(14-9(3)15)21(18,19)20-10(12(16)17)6-4-5-7-13/h8,10-11H,4-7,13H2,1-3H3,(H,14,15)(H,16,17)(H,18,19)/t10?,11-/m0/s1 |
| InChIKey | XYKGHBCYBABTCK-DTIOYNMSSA-N |
| XLogP | 0.89 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|