C24H39N2O6P — CID 14630782
2-[[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-cyclohexylamino]acetic acid (PubChem CID 14630782) has the molecular formula C24H39N2O6P and a molecular weight of 482.56 g/mol. Its IUPAC name is 2-[[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-cyclohexylamino]acetic acid.
| Compound Name | 2-[[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-cyclohexylamino]acetic acid |
|---|---|
| PubChem CID | 14630782 |
| Molecular Formula | C24H39N2O6P |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 2-[[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-cyclohexylamino]acetic acid |
| SMILES | NCCCC[C@H](OP(=O)(O)CCCCc1ccccc1)C(=O)N(CC(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C24H39N2O6P/c25-17-9-7-16-22(24(29)26(19-23(27)28)21-14-5-2-6-15-21)32-33(30,31)18-10-8-13-20-11-3-1-4-12-20/h1,3-4,11-12,21-22H,2,5-10,13-19,25H2,(H,27,28)(H,30,31)/t22-/m0/s1 |
| InChIKey | NPCGZZIMQIFYNV-QFIPXVFZSA-N |
| XLogP | 3.95 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|