C21H30FLi2N2O6P — CID 102504463
dilithium;(2S,4S)-1-[(2S)-6-amino-2-[oxido(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-fluoropyrrolidine-2-carboxylate (PubChem CID 102504463) has the molecular formula C21H30FLi2N2O6P and a molecular weight of 470.33 g/mol. Its IUPAC name is dilithium;(2S,4S)-1-[(2S)-6-amino-2-[oxido(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-fluoropyrrolidine-2-carboxylate.
| Compound Name | dilithium;(2S,4S)-1-[(2S)-6-amino-2-[oxido(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-fluoropyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 102504463 |
| Molecular Formula | C21H30FLi2N2O6P |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | dilithium;(2S,4S)-1-[(2S)-6-amino-2-[oxido(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-fluoropyrrolidine-2-carboxylate |
| SMILES | NCCCC[C@H](OP(=O)([O-])CCCCc1ccccc1)C(=O)N1C[C@@H](F)C[C@H]1C(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C21H32FN2O6P.2Li/c22-17-14-18(21(26)27)24(15-17)20(25)19(11-4-6-12-23)30-31(28,29)13-7-5-10-16-8-2-1-3-9-16;;/h1-3,8-9,17-19H,4-7,10-15,23H2,(H,26,27)(H,28,29);;/q;2*+1/p-2/t17-,18-,19-;;/m0../s1 |
| InChIKey | YNWOJYFDCVPTQF-KXJNLPJSSA-L |
| XLogP | -5.23 |
| TPSA | 135.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | -5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|