C24H36N2O5 — CID 13145559
2-[[(2S)-2-[[(2S)-1-butoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-cyclopentylamino]acetic acid (PubChem CID 13145559) has the molecular formula C24H36N2O5 and a molecular weight of 432.56 g/mol. Its IUPAC name is 2-[[(2S)-2-[[(2S)-1-butoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-cyclopentylamino]acetic acid.
| Compound Name | 2-[[(2S)-2-[[(2S)-1-butoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-cyclopentylamino]acetic acid |
|---|---|
| PubChem CID | 13145559 |
| Molecular Formula | C24H36N2O5 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 2-[[(2S)-2-[[(2S)-1-butoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-cyclopentylamino]acetic acid |
| SMILES | CCCCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N(CC(=O)O)C1CCCC1 |
| InChI | InChI=1S/C24H36N2O5/c1-3-4-16-31-24(30)21(15-14-19-10-6-5-7-11-19)25-18(2)23(29)26(17-22(27)28)20-12-8-9-13-20/h5-7,10-11,18,20-21,25H,3-4,8-9,12-17H2,1-2H3,(H,27,28)/t18-,21-/m0/s1 |
| InChIKey | XSHOXIUCPQRBPE-RXVVDRJESA-N |
| XLogP | 3.16 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|