C24H39N3O6 — CID 142974762
4-nitrooxybutyl 2-[[1-[butyl(propan-2-yl)amino]-1-oxopropan-2-yl]amino]-4-phenylbutanoate (PubChem CID 142974762) has the molecular formula C24H39N3O6 and a molecular weight of 465.59 g/mol. Its IUPAC name is 4-nitrooxybutyl 2-[[1-[butyl(propan-2-yl)amino]-1-oxopropan-2-yl]amino]-4-phenylbutanoate.
| Compound Name | 4-nitrooxybutyl 2-[[1-[butyl(propan-2-yl)amino]-1-oxopropan-2-yl]amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 142974762 |
| Molecular Formula | C24H39N3O6 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | 4-nitrooxybutyl 2-[[1-[butyl(propan-2-yl)amino]-1-oxopropan-2-yl]amino]-4-phenylbutanoate |
| SMILES | CCCCN(C(=O)C(C)NC(CCc1ccccc1)C(=O)OCCCCO[N+](=O)[O-])C(C)C |
| InChI | InChI=1S/C24H39N3O6/c1-5-6-16-26(19(2)3)23(28)20(4)25-22(15-14-21-12-8-7-9-13-21)24(29)32-17-10-11-18-33-27(30)31/h7-9,12-13,19-20,22,25H,5-6,10-11,14-18H2,1-4H3 |
| InChIKey | GOUVOVRGABUQSW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|