C27H41N3O8 — CID 142974882
2-[[1-[(2-methylcyclopentyl)-[1-(5-nitrooxypentoxy)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-phenylbutanoic acid (PubChem CID 142974882) has the molecular formula C27H41N3O8 and a molecular weight of 535.64 g/mol. Its IUPAC name is 2-[[1-[(2-methylcyclopentyl)-[1-(5-nitrooxypentoxy)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-phenylbutanoic acid.
| Compound Name | 2-[[1-[(2-methylcyclopentyl)-[1-(5-nitrooxypentoxy)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 142974882 |
| Molecular Formula | C27H41N3O8 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | 2-[[1-[(2-methylcyclopentyl)-[1-(5-nitrooxypentoxy)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-phenylbutanoic acid |
| SMILES | CC(NC(CCc1ccccc1)C(=O)O)C(=O)N(C(C)C(=O)OCCCCCO[N+](=O)[O-])C1CCCC1C |
| InChI | InChI=1S/C27H41N3O8/c1-19-11-10-14-24(19)29(21(3)27(34)37-17-8-5-9-18-38-30(35)36)25(31)20(2)28-23(26(32)33)16-15-22-12-6-4-7-13-22/h4,6-7,12-13,19-21,23-24,28H,5,8-11,14-18H2,1-3H3,(H,32,33) |
| InChIKey | HPRMMTLAHLNNIX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|