C23H29N3O5 — CID 70401707
2-[anilino-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]amino]acetic acid (PubChem CID 70401707) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-[anilino-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]amino]acetic acid.
| Compound Name | 2-[anilino-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 70401707 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 2-[anilino-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]amino]acetic acid |
| SMILES | CCOC(=O)C(CCc1ccccc1)N[C@@H](C)C(=O)N(CC(=O)O)Nc1ccccc1 |
| InChI | InChI=1S/C23H29N3O5/c1-3-31-23(30)20(15-14-18-10-6-4-7-11-18)24-17(2)22(29)26(16-21(27)28)25-19-12-8-5-9-13-19/h4-13,17,20,24-25H,3,14-16H2,1-2H3,(H,27,28)/t17-,20?/m0/s1 |
| InChIKey | YXGPSCHHVXEHON-DIMJTDRSSA-N |
| XLogP | 2.47 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|