C25H41N3O8 — CID 89202792
ethyl 2-[[1-[[1-[4-(dihydroxyamino)oxybutoxy]-1-oxobutan-2-yl]-ethylamino]-1-oxopropan-2-yl]amino]-4-phenylbutanoate (PubChem CID 89202792) has the molecular formula C25H41N3O8 and a molecular weight of 511.62 g/mol. Its IUPAC name is ethyl 2-[[1-[[1-[4-(dihydroxyamino)oxybutoxy]-1-oxobutan-2-yl]-ethylamino]-1-oxopropan-2-yl]amino]-4-phenylbutanoate.
| Compound Name | ethyl 2-[[1-[[1-[4-(dihydroxyamino)oxybutoxy]-1-oxobutan-2-yl]-ethylamino]-1-oxopropan-2-yl]amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 89202792 |
| Molecular Formula | C25H41N3O8 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | ethyl 2-[[1-[[1-[4-(dihydroxyamino)oxybutoxy]-1-oxobutan-2-yl]-ethylamino]-1-oxopropan-2-yl]amino]-4-phenylbutanoate |
| SMILES | CCOC(=O)C(CCc1ccccc1)NC(C)C(=O)N(CC)C(CC)C(=O)OCCCCON(O)O |
| InChI | InChI=1S/C25H41N3O8/c1-5-22(25(31)35-17-11-12-18-36-28(32)33)27(6-2)23(29)19(4)26-21(24(30)34-7-3)16-15-20-13-9-8-10-14-20/h8-10,13-14,19,21-22,26,32-33H,5-7,11-12,15-18H2,1-4H3 |
| InChIKey | LHTMYXWZSWTXFX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 137.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|