C27H41N3O5 — CID 57002525
2-[2,3-dihydro-1H-inden-2-yl-[(2S)-2-[(1-ethoxy-1-oxo-6-piperidin-4-ylhexan-2-yl)amino]propanoyl]amino]acetic acid (PubChem CID 57002525) has the molecular formula C27H41N3O5 and a molecular weight of 487.64 g/mol. Its IUPAC name is 2-[2,3-dihydro-1H-inden-2-yl-[(2S)-2-[(1-ethoxy-1-oxo-6-piperidin-4-ylhexan-2-yl)amino]propanoyl]amino]acetic acid.
| Compound Name | 2-[2,3-dihydro-1H-inden-2-yl-[(2S)-2-[(1-ethoxy-1-oxo-6-piperidin-4-ylhexan-2-yl)amino]propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 57002525 |
| Molecular Formula | C27H41N3O5 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.30 |
| IUPAC Name | 2-[2,3-dihydro-1H-inden-2-yl-[(2S)-2-[(1-ethoxy-1-oxo-6-piperidin-4-ylhexan-2-yl)amino]propanoyl]amino]acetic acid |
| SMILES | CCOC(=O)C(CCCCC1CCNCC1)N[C@@H](C)C(=O)N(CC(=O)O)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C27H41N3O5/c1-3-35-27(34)24(11-7-4-8-20-12-14-28-15-13-20)29-19(2)26(33)30(18-25(31)32)23-16-21-9-5-6-10-22(21)17-23/h5-6,9-10,19-20,23-24,28-29H,3-4,7-8,11-18H2,1-2H3,(H,31,32)/t19-,24?/m0/s1 |
| InChIKey | SWMGHSLGRRBVJS-XGLRFROISA-N |
| XLogP | 2.54 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|