C28H44N2O6 — CID 10323860
benzyl 4-[(5S)-6-ethoxy-5-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]amino]-6-oxohexyl]piperidine-1-carboxylate (PubChem CID 10323860) has the molecular formula C28H44N2O6 and a molecular weight of 504.67 g/mol. Its IUPAC name is benzyl 4-[(5S)-6-ethoxy-5-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]amino]-6-oxohexyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[(5S)-6-ethoxy-5-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]amino]-6-oxohexyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10323860 |
| Molecular Formula | C28H44N2O6 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | benzyl 4-[(5S)-6-ethoxy-5-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]amino]-6-oxohexyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)[C@H](CCCCC1CCN(C(=O)OCc2ccccc2)CC1)N[C@@H](C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H44N2O6/c1-6-34-26(32)24(29-21(2)25(31)36-28(3,4)5)15-11-10-12-22-16-18-30(19-17-22)27(33)35-20-23-13-8-7-9-14-23/h7-9,13-14,21-22,24,29H,6,10-12,15-20H2,1-5H3/t21-,24-/m0/s1 |
| InChIKey | YRHSSPNVOQZFEX-URXFXBBRSA-N |
| XLogP | 4.85 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|