C30H41N3O6S — CID 70416379
(2R)-3-(2-aminophenyl)sulfanyl-2-[[1-ethoxy-1-oxo-6-(1-phenylmethoxycarbonylpiperidin-4-yl)hexan-2-yl]amino]propanoic acid (PubChem CID 70416379) has the molecular formula C30H41N3O6S and a molecular weight of 571.74 g/mol. Its IUPAC name is (2R)-3-(2-aminophenyl)sulfanyl-2-[[1-ethoxy-1-oxo-6-(1-phenylmethoxycarbonylpiperidin-4-yl)hexan-2-yl]amino]propanoic acid.
| Compound Name | (2R)-3-(2-aminophenyl)sulfanyl-2-[[1-ethoxy-1-oxo-6-(1-phenylmethoxycarbonylpiperidin-4-yl)hexan-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 70416379 |
| Molecular Formula | C30H41N3O6S |
| Molecular Weight | 571.74 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | (2R)-3-(2-aminophenyl)sulfanyl-2-[[1-ethoxy-1-oxo-6-(1-phenylmethoxycarbonylpiperidin-4-yl)hexan-2-yl]amino]propanoic acid |
| SMILES | CCOC(=O)C(CCCCC1CCN(C(=O)OCc2ccccc2)CC1)N[C@@H](CSc1ccccc1N)C(=O)O |
| InChI | InChI=1S/C30H41N3O6S/c1-2-38-29(36)25(32-26(28(34)35)21-40-27-15-9-7-13-24(27)31)14-8-6-10-22-16-18-33(19-17-22)30(37)39-20-23-11-4-3-5-12-23/h3-5,7,9,11-13,15,22,25-26,32H,2,6,8,10,14,16-21,31H2,1H3,(H,34,35)/t25?,26-/m0/s1 |
| InChIKey | HFRQVGHYVDZSOB-AMVUTOCUSA-N |
| XLogP | 4.94 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.74 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|